C11H6N3NaO3S — CID 70484765
sodium (5S)-7-oxo-6-(pyrazin-2-ylmethylidene)-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 70484765) has the molecular formula C11H6N3NaO3S and a molecular weight of 283.24 g/mol. Its IUPAC name is sodium (5S)-7-oxo-6-(pyrazin-2-ylmethylidene)-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | sodium (5S)-7-oxo-6-(pyrazin-2-ylmethylidene)-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 70484765 |
| Molecular Formula | C11H6N3NaO3S |
| Molecular Weight | 283.24 g/mol |
| Exact Mass | 283.00 |
| IUPAC Name | sodium (5S)-7-oxo-6-(pyrazin-2-ylmethylidene)-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | O=C([O-])C1=CS[C@H]2C(=Cc3cnccn3)C(=O)N12.[Na+] |
| InChI | InChI=1S/C11H7N3O3S.Na/c15-9-7(3-6-4-12-1-2-13-6)10-14(9)8(5-18-10)11(16)17;/h1-5,10H,(H,16,17);/q;+1/p-1/t10-;/m0./s1 |
| InChIKey | GKJBTPXKXHXUKU-PPHPATTJSA-M |
| XLogP | -3.63 |
| TPSA | 86.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.24 |
| LogP ≤ 5 | -3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|