C11H18N2O2 — CID 70485343
6-(1H-imidazol-5-yl)-3,3-dimethylhexanoic acid (PubChem CID 70485343) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 6-(1H-imidazol-5-yl)-3,3-dimethylhexanoic acid.
| Compound Name | 6-(1H-imidazol-5-yl)-3,3-dimethylhexanoic acid |
|---|---|
| PubChem CID | 70485343 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 6-(1H-imidazol-5-yl)-3,3-dimethylhexanoic acid |
| SMILES | CC(C)(CCCc1cnc[nH]1)CC(=O)O |
| InChI | InChI=1S/C11H18N2O2/c1-11(2,6-10(14)15)5-3-4-9-7-12-8-13-9/h7-8H,3-6H2,1-2H3,(H,12,13)(H,14,15) |
| InChIKey | XVOFNWROQOYFIH-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |