C10H20N2OSi — CID 71167987
hydroxy-[4-(1H-imidazol-5-yl)-2-methylbutan-2-yl]-dimethylsilane (PubChem CID 71167987) has the molecular formula C10H20N2OSi and a molecular weight of 212.37 g/mol. Its IUPAC name is hydroxy-[4-(1H-imidazol-5-yl)-2-methylbutan-2-yl]-dimethylsilane.
| Compound Name | hydroxy-[4-(1H-imidazol-5-yl)-2-methylbutan-2-yl]-dimethylsilane |
|---|---|
| PubChem CID | 71167987 |
| Molecular Formula | C10H20N2OSi |
| Molecular Weight | 212.37 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | hydroxy-[4-(1H-imidazol-5-yl)-2-methylbutan-2-yl]-dimethylsilane |
| SMILES | CC(C)(CCc1cnc[nH]1)[Si](C)(C)O |
| InChI | InChI=1S/C10H20N2OSi/c1-10(2,14(3,4)13)6-5-9-7-11-8-12-9/h7-8,13H,5-6H2,1-4H3,(H,11,12) |
| InChIKey | WSWMSYOBQQYWCO-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.37 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|