C8H14N3O+ — CID 23403341
[1-(1H-imidazol-5-yl)-2-methyl-3-oxobutan-2-yl]azanium (PubChem CID 23403341) has the molecular formula C8H14N3O+ and a molecular weight of 168.22 g/mol. Its IUPAC name is [1-(1H-imidazol-5-yl)-2-methyl-3-oxobutan-2-yl]azanium.
| Compound Name | [1-(1H-imidazol-5-yl)-2-methyl-3-oxobutan-2-yl]azanium |
|---|---|
| PubChem CID | 23403341 |
| Molecular Formula | C8H14N3O+ |
| Molecular Weight | 168.22 g/mol |
| Exact Mass | 168.11 |
| IUPAC Name | [1-(1H-imidazol-5-yl)-2-methyl-3-oxobutan-2-yl]azanium |
| SMILES | CC(=O)C(C)([NH3+])Cc1cnc[nH]1 |
| InChI | InChI=1S/C8H13N3O/c1-6(12)8(2,9)3-7-4-10-5-11-7/h4-5H,3,9H2,1-2H3,(H,10,11)/p+1 |
| InChIKey | MVQLKFFMVNPDQZ-UHFFFAOYSA-O |
| XLogP | -0.46 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.22 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |