C6H8N3O3 — CID 101407841
CID 101407841 (PubChem CID 101407841) has the molecular formula C6H8N3O3 and a molecular weight of 170.15 g/mol.
| Compound Name | CID 101407841 |
|---|---|
| PubChem CID | 101407841 |
| Molecular Formula | C6H8N3O3 |
| Molecular Weight | 170.15 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | — |
| SMILES | N[C@@]([O])(Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C6H8N3O3/c7-6(12,5(10)11)1-4-2-8-3-9-4/h2-3H,1,7H2,(H,8,9)(H,10,11)/t6-/m1/s1 |
| InChIKey | QTPLPVONLVBJMI-ZCFIWIBFSA-N |
| XLogP | -0.88 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.15 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|