C13H14N4O2 — CID 141121043
(2S)-2-benzyl-2-diazenyl-3-(1H-imidazol-5-yl)propanoic acid (PubChem CID 141121043) has the molecular formula C13H14N4O2 and a molecular weight of 258.28 g/mol. Its IUPAC name is (2S)-2-benzyl-2-diazenyl-3-(1H-imidazol-5-yl)propanoic acid.
| Compound Name | (2S)-2-benzyl-2-diazenyl-3-(1H-imidazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 141121043 |
| Molecular Formula | C13H14N4O2 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | (2S)-2-benzyl-2-diazenyl-3-(1H-imidazol-5-yl)propanoic acid |
| SMILES | [H]/N=N/[C@@](Cc1ccccc1)(Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C13H14N4O2/c14-17-13(12(18)19,7-11-8-15-9-16-11)6-10-4-2-1-3-5-10/h1-5,8-9,14H,6-7H2,(H,15,16)(H,18,19)/b17-14+/t13-/m0/s1 |
| InChIKey | OODQWOJBPNMSJP-CQQXOOPHSA-N |
| XLogP | 2.05 |
| TPSA | 102.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|