C9H16ClN3O2 — CID 90679615
(2R)-2-amino-2-(1H-imidazol-5-ylmethyl)-3-methylbutanoic acid;hydrochloride (PubChem CID 90679615) has the molecular formula C9H16ClN3O2 and a molecular weight of 233.70 g/mol. Its IUPAC name is (2R)-2-amino-2-(1H-imidazol-5-ylmethyl)-3-methylbutanoic acid;hydrochloride.
| Compound Name | (2R)-2-amino-2-(1H-imidazol-5-ylmethyl)-3-methylbutanoic acid;hydrochloride |
|---|---|
| PubChem CID | 90679615 |
| Molecular Formula | C9H16ClN3O2 |
| Molecular Weight | 233.70 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | (2R)-2-amino-2-(1H-imidazol-5-ylmethyl)-3-methylbutanoic acid;hydrochloride |
| SMILES | CC(C)[C@](N)(Cc1cnc[nH]1)C(=O)O.Cl |
| InChI | InChI=1S/C9H15N3O2.ClH/c1-6(2)9(10,8(13)14)3-7-4-11-5-12-7;/h4-6H,3,10H2,1-2H3,(H,11,12)(H,13,14);1H/t9-;/m1./s1 |
| InChIKey | LKHYZNZKOAPFIX-SBSPUUFOSA-N |
| XLogP | 0.81 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.70 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |