C26H24FN3O2 — CID 22821410
trityl (2S)-2-amino-2-(fluoromethyl)-3-(1H-imidazol-5-yl)propanoate (PubChem CID 22821410) has the molecular formula C26H24FN3O2 and a molecular weight of 429.50 g/mol. Its IUPAC name is trityl (2S)-2-amino-2-(fluoromethyl)-3-(1H-imidazol-5-yl)propanoate.
| Compound Name | trityl (2S)-2-amino-2-(fluoromethyl)-3-(1H-imidazol-5-yl)propanoate |
|---|---|
| PubChem CID | 22821410 |
| Molecular Formula | C26H24FN3O2 |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | trityl (2S)-2-amino-2-(fluoromethyl)-3-(1H-imidazol-5-yl)propanoate |
| SMILES | N[C@@](CF)(Cc1cnc[nH]1)C(=O)OC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H24FN3O2/c27-18-25(28,16-23-17-29-19-30-23)24(31)32-26(20-10-4-1-5-11-20,21-12-6-2-7-13-21)22-14-8-3-9-15-22/h1-15,17,19H,16,18,28H2,(H,29,30)/t25-/m1/s1 |
| InChIKey | WNHZEBDNRAZMRH-RUZDIDTESA-N |
| XLogP | 4.15 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|