C18H20FN3O8S2 — CID 86738562
methyl (2S)-2-amino-2-(fluoromethyl)-3-(1H-imidazol-5-yl)propanoate;naphthalene-1,5-disulfonic acid (PubChem CID 86738562) has the molecular formula C18H20FN3O8S2 and a molecular weight of 489.50 g/mol. Its IUPAC name is methyl (2S)-2-amino-2-(fluoromethyl)-3-(1H-imidazol-5-yl)propanoate;naphthalene-1,5-disulfonic acid.
| Compound Name | methyl (2S)-2-amino-2-(fluoromethyl)-3-(1H-imidazol-5-yl)propanoate;naphthalene-1,5-disulfonic acid |
|---|---|
| PubChem CID | 86738562 |
| Molecular Formula | C18H20FN3O8S2 |
| Molecular Weight | 489.50 g/mol |
| Exact Mass | 489.07 |
| IUPAC Name | methyl (2S)-2-amino-2-(fluoromethyl)-3-(1H-imidazol-5-yl)propanoate;naphthalene-1,5-disulfonic acid |
| SMILES | COC(=O)[C@](N)(CF)Cc1cnc[nH]1.O=S(=O)(O)c1cccc2c(S(=O)(=O)O)cccc12 |
| InChI | InChI=1S/C10H8O6S2.C8H12FN3O2/c11-17(12,13)9-5-1-3-7-8(9)4-2-6-10(7)18(14,15)16;1-14-7(13)8(10,4-9)2-6-3-11-5-12-6/h1-6H,(H,11,12,13)(H,14,15,16);3,5H,2,4,10H2,1H3,(H,11,12)/t;8-/m.1/s1 |
| InChIKey | XGDVOCURNFLEIJ-NIFFTEIASA-N |
| XLogP | 1.13 |
| TPSA | 189.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.50 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|