C11H15N3O3 — CID 25206846
(2R)-2-(dimethylamino)-2-(1H-imidazol-5-ylmethyl)-3-oxopent-4-enoic acid (PubChem CID 25206846) has the molecular formula C11H15N3O3 and a molecular weight of 237.26 g/mol. Its IUPAC name is (2R)-2-(dimethylamino)-2-(1H-imidazol-5-ylmethyl)-3-oxopent-4-enoic acid.
| Compound Name | (2R)-2-(dimethylamino)-2-(1H-imidazol-5-ylmethyl)-3-oxopent-4-enoic acid |
|---|---|
| PubChem CID | 25206846 |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | (2R)-2-(dimethylamino)-2-(1H-imidazol-5-ylmethyl)-3-oxopent-4-enoic acid |
| SMILES | C=CC(=O)[C@](Cc1cnc[nH]1)(C(=O)O)N(C)C |
| InChI | InChI=1S/C11H15N3O3/c1-4-9(15)11(10(16)17,14(2)3)5-8-6-12-7-13-8/h4,6-7H,1,5H2,2-3H3,(H,12,13)(H,16,17)/t11-/m1/s1 |
| InChIKey | GSYRDPTUUKKBBK-LLVKDONJSA-N |
| XLogP | 0.09 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|