C33H39N3O6S — CID 70485433
[9-(methanesulfonamido)-3-(5-phenylpentan-2-yloxy)phenanthridin-1-yl] 4-morpholin-4-ylbutanoate (PubChem CID 70485433) has the molecular formula C33H39N3O6S and a molecular weight of 605.76 g/mol. Its IUPAC name is [9-(methanesulfonamido)-3-(5-phenylpentan-2-yloxy)phenanthridin-1-yl] 4-morpholin-4-ylbutanoate.
| Compound Name | [9-(methanesulfonamido)-3-(5-phenylpentan-2-yloxy)phenanthridin-1-yl] 4-morpholin-4-ylbutanoate |
|---|---|
| PubChem CID | 70485433 |
| Molecular Formula | C33H39N3O6S |
| Molecular Weight | 605.76 g/mol |
| Exact Mass | 605.26 |
| IUPAC Name | [9-(methanesulfonamido)-3-(5-phenylpentan-2-yloxy)phenanthridin-1-yl] 4-morpholin-4-ylbutanoate |
| SMILES | CC(CCCc1ccccc1)Oc1cc(OC(=O)CCCN2CCOCC2)c2c(c1)ncc1ccc(NS(C)(=O)=O)cc12 |
| InChI | InChI=1S/C33H39N3O6S/c1-24(8-6-11-25-9-4-3-5-10-25)41-28-21-30-33(29-20-27(35-43(2,38)39)14-13-26(29)23-34-30)31(22-28)42-32(37)12-7-15-36-16-18-40-19-17-36/h3-5,9-10,13-14,20-24,35H,6-8,11-12,15-19H2,1-2H3 |
| InChIKey | CDJBNWIOSPVALZ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 107.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.76 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|