C22H35FO — CID 70485947
4-[4-(4-butylcyclohexyl)-2-fluorohexyl]phenol (PubChem CID 70485947) has the molecular formula C22H35FO and a molecular weight of 334.52 g/mol. Its IUPAC name is 4-[4-(4-butylcyclohexyl)-2-fluorohexyl]phenol.
| Compound Name | 4-[4-(4-butylcyclohexyl)-2-fluorohexyl]phenol |
|---|---|
| PubChem CID | 70485947 |
| Molecular Formula | C22H35FO |
| Molecular Weight | 334.52 g/mol |
| Exact Mass | 334.27 |
| IUPAC Name | 4-[4-(4-butylcyclohexyl)-2-fluorohexyl]phenol |
| SMILES | CCCCC1CCC(C(CC)CC(F)Cc2ccc(O)cc2)CC1 |
| InChI | InChI=1S/C22H35FO/c1-3-5-6-17-7-11-20(12-8-17)19(4-2)16-21(23)15-18-9-13-22(24)14-10-18/h9-10,13-14,17,19-21,24H,3-8,11-12,15-16H2,1-2H3 |
| InChIKey | DCVSSZGDYOYBTN-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.52 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |