C23H29NO4 — CID 70486243
(Z)-7-[(1R,2R,3S,4S)-3-[[(3-oxo-3-phenylprop-1-enyl)amino]methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid (PubChem CID 70486243) has the molecular formula C23H29NO4 and a molecular weight of 383.49 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3S,4S)-3-[[(3-oxo-3-phenylprop-1-enyl)amino]methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3S,4S)-3-[[(3-oxo-3-phenylprop-1-enyl)amino]methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70486243 |
| Molecular Formula | C23H29NO4 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | (Z)-7-[(1R,2R,3S,4S)-3-[[(3-oxo-3-phenylprop-1-enyl)amino]methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\C[C@@H]1[C@@H](CNC=CC(=O)c2ccccc2)[C@@H]2CC[C@H]1O2 |
| InChI | InChI=1S/C23H29NO4/c25-20(17-8-4-3-5-9-17)14-15-24-16-19-18(21-12-13-22(19)28-21)10-6-1-2-7-11-23(26)27/h1,3-6,8-9,14-15,18-19,21-22,24H,2,7,10-13,16H2,(H,26,27)/b6-1-,15-14?/t18-,19-,21-,22+/m1/s1 |
| InChIKey | ISEUSUHBWLUTTQ-SCVZPSRDSA-N |
| XLogP | 3.97 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|