C12H17N3O6 — CID 70489760
2-[3-(3-aminopropanoylamino)-4-methoxyphenoxy]ethyl nitrate (PubChem CID 70489760) has the molecular formula C12H17N3O6 and a molecular weight of 299.28 g/mol. Its IUPAC name is 2-[3-(3-aminopropanoylamino)-4-methoxyphenoxy]ethyl nitrate.
| Compound Name | 2-[3-(3-aminopropanoylamino)-4-methoxyphenoxy]ethyl nitrate |
|---|---|
| PubChem CID | 70489760 |
| Molecular Formula | C12H17N3O6 |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 2-[3-(3-aminopropanoylamino)-4-methoxyphenoxy]ethyl nitrate |
| SMILES | COc1ccc(OCCO[N+](=O)[O-])cc1NC(=O)CCN |
| InChI | InChI=1S/C12H17N3O6/c1-19-11-3-2-9(20-6-7-21-15(17)18)8-10(11)14-12(16)4-5-13/h2-3,8H,4-7,13H2,1H3,(H,14,16) |
| InChIKey | QBXQCNUMWMBMKK-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 125.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.28 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|