C21H28N2O7 — CID 70489995
diethyl 2-(dimethoxymethyl)-6-methyl-4-(2-methyl-1-oxidopyridin-1-ium-3-yl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 70489995) has the molecular formula C21H28N2O7 and a molecular weight of 420.46 g/mol. Its IUPAC name is diethyl 2-(dimethoxymethyl)-6-methyl-4-(2-methyl-1-oxidopyridin-1-ium-3-yl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | diethyl 2-(dimethoxymethyl)-6-methyl-4-(2-methyl-1-oxidopyridin-1-ium-3-yl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 70489995 |
| Molecular Formula | C21H28N2O7 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | diethyl 2-(dimethoxymethyl)-6-methyl-4-(2-methyl-1-oxidopyridin-1-ium-3-yl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(C(OC)OC)=C(C(=O)OCC)C1c1ccc[n+]([O-])c1C |
| InChI | InChI=1S/C21H28N2O7/c1-7-29-19(24)15-12(3)22-18(21(27-5)28-6)17(20(25)30-8-2)16(15)14-10-9-11-23(26)13(14)4/h9-11,16,21-22H,7-8H2,1-6H3 |
| InChIKey | LPEXRNAHUGIIRB-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 110.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|