C17H22O2 — CID 70490928
2-[(1S)-1-hydroxy-5-methylhexyl]naphthalen-1-ol (PubChem CID 70490928) has the molecular formula C17H22O2 and a molecular weight of 258.36 g/mol. Its IUPAC name is 2-[(1S)-1-hydroxy-5-methylhexyl]naphthalen-1-ol.
| Compound Name | 2-[(1S)-1-hydroxy-5-methylhexyl]naphthalen-1-ol |
|---|---|
| PubChem CID | 70490928 |
| Molecular Formula | C17H22O2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | 2-[(1S)-1-hydroxy-5-methylhexyl]naphthalen-1-ol |
| SMILES | CC(C)CCC[C@H](O)c1ccc2ccccc2c1O |
| InChI | InChI=1S/C17H22O2/c1-12(2)6-5-9-16(18)15-11-10-13-7-3-4-8-14(13)17(15)19/h3-4,7-8,10-12,16,18-19H,5-6,9H2,1-2H3/t16-/m0/s1 |
| InChIKey | ZDGUJEHITFIFRW-INIZCTEOSA-N |
| XLogP | 4.41 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |