C32H35N3O3 — CID 70491439
[3-[benzyl-[1-(2-phenylethyl)piperidin-4-yl]carbamoyl]-2-methyl-1H-indol-5-yl] acetate (PubChem CID 70491439) has the molecular formula C32H35N3O3 and a molecular weight of 509.65 g/mol. Its IUPAC name is [3-[benzyl-[1-(2-phenylethyl)piperidin-4-yl]carbamoyl]-2-methyl-1H-indol-5-yl] acetate.
| Compound Name | [3-[benzyl-[1-(2-phenylethyl)piperidin-4-yl]carbamoyl]-2-methyl-1H-indol-5-yl] acetate |
|---|---|
| PubChem CID | 70491439 |
| Molecular Formula | C32H35N3O3 |
| Molecular Weight | 509.65 g/mol |
| Exact Mass | 509.27 |
| IUPAC Name | [3-[benzyl-[1-(2-phenylethyl)piperidin-4-yl]carbamoyl]-2-methyl-1H-indol-5-yl] acetate |
| SMILES | CC(=O)Oc1ccc2[nH]c(C)c(C(=O)N(Cc3ccccc3)C3CCN(CCc4ccccc4)CC3)c2c1 |
| InChI | InChI=1S/C32H35N3O3/c1-23-31(29-21-28(38-24(2)36)13-14-30(29)33-23)32(37)35(22-26-11-7-4-8-12-26)27-16-19-34(20-17-27)18-15-25-9-5-3-6-10-25/h3-14,21,27,33H,15-20,22H2,1-2H3 |
| InChIKey | QLOWRAXBJWQBAS-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.65 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|