C22H42N2 — CID 70491830
1-[(E)-nonadec-3-en-3-yl]-4,5-dihydroimidazole (PubChem CID 70491830) has the molecular formula C22H42N2 and a molecular weight of 334.59 g/mol. Its IUPAC name is 1-[(E)-nonadec-3-en-3-yl]-4,5-dihydroimidazole.
| Compound Name | 1-[(E)-nonadec-3-en-3-yl]-4,5-dihydroimidazole |
|---|---|
| PubChem CID | 70491830 |
| Molecular Formula | C22H42N2 |
| Molecular Weight | 334.59 g/mol |
| Exact Mass | 334.33 |
| IUPAC Name | 1-[(E)-nonadec-3-en-3-yl]-4,5-dihydroimidazole |
| SMILES | CCCCCCCCCCCCCCC/C=C(\CC)N1C=NCC1 |
| InChI | InChI=1S/C22H42N2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22(4-2)24-20-19-23-21-24/h18,21H,3-17,19-20H2,1-2H3/b22-18+ |
| InChIKey | NRLZTNJSURIMQX-RELWKKBWSA-N |
| XLogP | 7.11 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.59 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|