C22H38N2O3 — CID 154636012
[(Z)-octadec-9-enoyl] 4,5-dihydroimidazole-1-carboxylate (PubChem CID 154636012) has the molecular formula C22H38N2O3 and a molecular weight of 378.56 g/mol. Its IUPAC name is [(Z)-octadec-9-enoyl] 4,5-dihydroimidazole-1-carboxylate.
| Compound Name | [(Z)-octadec-9-enoyl] 4,5-dihydroimidazole-1-carboxylate |
|---|---|
| PubChem CID | 154636012 |
| Molecular Formula | C22H38N2O3 |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.29 |
| IUPAC Name | [(Z)-octadec-9-enoyl] 4,5-dihydroimidazole-1-carboxylate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC(=O)N1C=NCC1 |
| InChI | InChI=1S/C22H38N2O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(25)27-22(26)24-19-18-23-20-24/h9-10,20H,2-8,11-19H2,1H3/b10-9- |
| InChIKey | FVTBYNZENLQWPD-KTKRTIGZSA-N |
| XLogP | 6.03 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|