C18H29NO5 — CID 70493477
ethyl 3-[4-(3-amino-2-hydroxy-4-methylpentoxy)-3-methoxyphenyl]propanoate (PubChem CID 70493477) has the molecular formula C18H29NO5 and a molecular weight of 339.43 g/mol. Its IUPAC name is ethyl 3-[4-(3-amino-2-hydroxy-4-methylpentoxy)-3-methoxyphenyl]propanoate.
| Compound Name | ethyl 3-[4-(3-amino-2-hydroxy-4-methylpentoxy)-3-methoxyphenyl]propanoate |
|---|---|
| PubChem CID | 70493477 |
| Molecular Formula | C18H29NO5 |
| Molecular Weight | 339.43 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | ethyl 3-[4-(3-amino-2-hydroxy-4-methylpentoxy)-3-methoxyphenyl]propanoate |
| SMILES | CCOC(=O)CCc1ccc(OCC(O)C(N)C(C)C)c(OC)c1 |
| InChI | InChI=1S/C18H29NO5/c1-5-23-17(21)9-7-13-6-8-15(16(10-13)22-4)24-11-14(20)18(19)12(2)3/h6,8,10,12,14,18,20H,5,7,9,11,19H2,1-4H3 |
| InChIKey | BXRBGUOTBACZCP-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.43 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |