C17H24N2O5 — CID 70494874
1-(2,3-dihydro-1-benzofuran-5-yl)-2-methyl-3-piperidin-1-ylpropan-1-one;nitric acid (PubChem CID 70494874) has the molecular formula C17H24N2O5 and a molecular weight of 336.39 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzofuran-5-yl)-2-methyl-3-piperidin-1-ylpropan-1-one;nitric acid.
| Compound Name | 1-(2,3-dihydro-1-benzofuran-5-yl)-2-methyl-3-piperidin-1-ylpropan-1-one;nitric acid |
|---|---|
| PubChem CID | 70494874 |
| Molecular Formula | C17H24N2O5 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 1-(2,3-dihydro-1-benzofuran-5-yl)-2-methyl-3-piperidin-1-ylpropan-1-one;nitric acid |
| SMILES | CC(CN1CCCCC1)C(=O)c1ccc2c(c1)CCO2.O=[N+]([O-])O |
| InChI | InChI=1S/C17H23NO2.HNO3/c1-13(12-18-8-3-2-4-9-18)17(19)15-5-6-16-14(11-15)7-10-20-16;2-1(3)4/h5-6,11,13H,2-4,7-10,12H2,1H3;(H,2,3,4) |
| InChIKey | ABRFGDVXCXVSPK-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|