C27H44Cl2N2 — CID 70496478
N-butyl-N'-methyl-2-phenyl-N'-(2-phenylethyl)-2-propan-2-ylpentane-1,5-diamine;dihydrochloride (PubChem CID 70496478) has the molecular formula C27H44Cl2N2 and a molecular weight of 467.57 g/mol. Its IUPAC name is N-butyl-N'-methyl-2-phenyl-N'-(2-phenylethyl)-2-propan-2-ylpentane-1,5-diamine;dihydrochloride.
| Compound Name | N-butyl-N'-methyl-2-phenyl-N'-(2-phenylethyl)-2-propan-2-ylpentane-1,5-diamine;dihydrochloride |
|---|---|
| PubChem CID | 70496478 |
| Molecular Formula | C27H44Cl2N2 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 466.29 |
| IUPAC Name | N-butyl-N'-methyl-2-phenyl-N'-(2-phenylethyl)-2-propan-2-ylpentane-1,5-diamine;dihydrochloride |
| SMILES | CCCCNCC(CCCN(C)CCc1ccccc1)(c1ccccc1)C(C)C.Cl.Cl |
| InChI | InChI=1S/C27H42N2.2ClH/c1-5-6-20-28-23-27(24(2)3,26-16-11-8-12-17-26)19-13-21-29(4)22-18-25-14-9-7-10-15-25;;/h7-12,14-17,24,28H,5-6,13,18-23H2,1-4H3;2*1H |
| InChIKey | GZQHZOJWCYBDOA-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|