C22H37N — CID 70498965
N-[1-(2-ethenylphenyl)ethyl]dodecan-1-amine (PubChem CID 70498965) has the molecular formula C22H37N and a molecular weight of 315.55 g/mol. Its IUPAC name is N-[1-(2-ethenylphenyl)ethyl]dodecan-1-amine.
| Compound Name | N-[1-(2-ethenylphenyl)ethyl]dodecan-1-amine |
|---|---|
| PubChem CID | 70498965 |
| Molecular Formula | C22H37N |
| Molecular Weight | 315.55 g/mol |
| Exact Mass | 315.29 |
| IUPAC Name | N-[1-(2-ethenylphenyl)ethyl]dodecan-1-amine |
| SMILES | C=Cc1ccccc1C(C)NCCCCCCCCCCCC |
| InChI | InChI=1S/C22H37N/c1-4-6-7-8-9-10-11-12-13-16-19-23-20(3)22-18-15-14-17-21(22)5-2/h5,14-15,17-18,20,23H,2,4,6-13,16,19H2,1,3H3 |
| InChIKey | OAXMHMBUKCMHSF-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.55 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|