C18H20N2O3 — CID 70501076
2-benzamidoethyl (2S)-2-amino-3-phenylpropanoate (PubChem CID 70501076) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is 2-benzamidoethyl (2S)-2-amino-3-phenylpropanoate.
| Compound Name | 2-benzamidoethyl (2S)-2-amino-3-phenylpropanoate |
|---|---|
| PubChem CID | 70501076 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 2-benzamidoethyl (2S)-2-amino-3-phenylpropanoate |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)OCCNC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H20N2O3/c19-16(13-14-7-3-1-4-8-14)18(22)23-12-11-20-17(21)15-9-5-2-6-10-15/h1-10,16H,11-13,19H2,(H,20,21)/t16-/m0/s1 |
| InChIKey | DSXIDOQFMMPRDU-INIZCTEOSA-N |
| XLogP | 1.53 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|