C9H12O2 — CID 70501382
1-penta-1,4-dien-2-ylcyclopropane-1-carboxylic acid (PubChem CID 70501382) has the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. Its IUPAC name is 1-penta-1,4-dien-2-ylcyclopropane-1-carboxylic acid.
| Compound Name | 1-penta-1,4-dien-2-ylcyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 70501382 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | 1-penta-1,4-dien-2-ylcyclopropane-1-carboxylic acid |
| SMILES | C=CCC(=C)C1(C(=O)O)CC1 |
| InChI | InChI=1S/C9H12O2/c1-3-4-7(2)9(5-6-9)8(10)11/h3H,1-2,4-6H2,(H,10,11) |
| InChIKey | OVKCXXPDDLQTJN-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|