C16H28O6 — CID 161164365
4,4-bis(hydroxymethyl)cyclohexane-1,1-dicarboxylic acid;cyclohexane (PubChem CID 161164365) has the molecular formula C16H28O6 and a molecular weight of 316.39 g/mol. Its IUPAC name is 4,4-bis(hydroxymethyl)cyclohexane-1,1-dicarboxylic acid;cyclohexane.
| Compound Name | 4,4-bis(hydroxymethyl)cyclohexane-1,1-dicarboxylic acid;cyclohexane |
|---|---|
| PubChem CID | 161164365 |
| Molecular Formula | C16H28O6 |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 4,4-bis(hydroxymethyl)cyclohexane-1,1-dicarboxylic acid;cyclohexane |
| SMILES | C1CCCCC1.O=C(O)C1(C(=O)O)CCC(CO)(CO)CC1 |
| InChI | InChI=1S/C10H16O6.C6H12/c11-5-9(6-12)1-3-10(4-2-9,7(13)14)8(15)16;1-2-4-6-5-3-1/h11-12H,1-6H2,(H,13,14)(H,15,16);1-6H2 |
| InChIKey | UQIFRGKPOKPHGL-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|