C30H40N2O4S2 — CID 70502131
2-[4-(1H-indol-2-yl)-1,4-bis(pentylsulfonyl)butyl]-1H-indole (PubChem CID 70502131) has the molecular formula C30H40N2O4S2 and a molecular weight of 556.79 g/mol. Its IUPAC name is 2-[4-(1H-indol-2-yl)-1,4-bis(pentylsulfonyl)butyl]-1H-indole.
| Compound Name | 2-[4-(1H-indol-2-yl)-1,4-bis(pentylsulfonyl)butyl]-1H-indole |
|---|---|
| PubChem CID | 70502131 |
| Molecular Formula | C30H40N2O4S2 |
| Molecular Weight | 556.79 g/mol |
| Exact Mass | 556.24 |
| IUPAC Name | 2-[4-(1H-indol-2-yl)-1,4-bis(pentylsulfonyl)butyl]-1H-indole |
| SMILES | CCCCCS(=O)(=O)C(CCC(c1cc2ccccc2[nH]1)S(=O)(=O)CCCCC)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C30H40N2O4S2/c1-3-5-11-19-37(33,34)29(27-21-23-13-7-9-15-25(23)31-27)17-18-30(38(35,36)20-12-6-4-2)28-22-24-14-8-10-16-26(24)32-28/h7-10,13-16,21-22,29-32H,3-6,11-12,17-20H2,1-2H3 |
| InChIKey | VKVMVJOOIPCGFP-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 99.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.79 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|