C12H21N3O — CID 70503238
1,3-bis(prop-2-enylamino)azepan-2-one (PubChem CID 70503238) has the molecular formula C12H21N3O and a molecular weight of 223.32 g/mol. Its IUPAC name is 1,3-bis(prop-2-enylamino)azepan-2-one.
| Compound Name | 1,3-bis(prop-2-enylamino)azepan-2-one |
|---|---|
| PubChem CID | 70503238 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | 1,3-bis(prop-2-enylamino)azepan-2-one |
| SMILES | C=CCNC1CCCCN(NCC=C)C1=O |
| InChI | InChI=1S/C12H21N3O/c1-3-8-13-11-7-5-6-10-15(12(11)16)14-9-4-2/h3-4,11,13-14H,1-2,5-10H2 |
| InChIKey | QCYGADNVGRPIEO-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|