C31H48ClNO6 — CID 70504673
[2-[(8S,9S,10S,13S,14S,17R)-11,17-dihydroxy-1,10,13-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 5-(diethylamino)pentanoate;hydrochloride (PubChem CID 70504673) has the molecular formula C31H48ClNO6 and a molecular weight of 566.18 g/mol. Its IUPAC name is [2-[(8S,9S,10S,13S,14S,17R)-11,17-dihydroxy-1,10,13-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 5-(diethylamino)pentanoate;hydrochloride.
| Compound Name | [2-[(8S,9S,10S,13S,14S,17R)-11,17-dihydroxy-1,10,13-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 5-(diethylamino)pentanoate;hydrochloride |
|---|---|
| PubChem CID | 70504673 |
| Molecular Formula | C31H48ClNO6 |
| Molecular Weight | 566.18 g/mol |
| Exact Mass | 565.32 |
| IUPAC Name | [2-[(8S,9S,10S,13S,14S,17R)-11,17-dihydroxy-1,10,13-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 5-(diethylamino)pentanoate;hydrochloride |
| SMILES | CCN(CC)CCCCC(=O)OCC(=O)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)C=C(C)[C@]4(C)[C@H]3C(O)C[C@@]21C.Cl |
| InChI | InChI=1S/C31H47NO6.ClH/c1-6-32(7-2)15-9-8-10-27(36)38-19-26(35)31(37)14-13-24-23-12-11-21-17-22(33)16-20(3)30(21,5)28(23)25(34)18-29(24,31)4;/h16-17,23-25,28,34,37H,6-15,18-19H2,1-5H3;1H/t23-,24-,25?,28+,29-,30-,31-;/m0./s1 |
| InChIKey | MNHNDKFHWLCHJS-SWMWRSFQSA-N |
| XLogP | 4.43 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.18 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|