C30H35ClO6 — CID 67938169
[2-[(8S,9S,10S,13S,14S,17R)-11,17-dihydroxy-1,10,13-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 3-(chloromethyl)benzoate (PubChem CID 67938169) has the molecular formula C30H35ClO6 and a molecular weight of 527.06 g/mol. Its IUPAC name is [2-[(8S,9S,10S,13S,14S,17R)-11,17-dihydroxy-1,10,13-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 3-(chloromethyl)benzoate.
| Compound Name | [2-[(8S,9S,10S,13S,14S,17R)-11,17-dihydroxy-1,10,13-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 3-(chloromethyl)benzoate |
|---|---|
| PubChem CID | 67938169 |
| Molecular Formula | C30H35ClO6 |
| Molecular Weight | 527.06 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | [2-[(8S,9S,10S,13S,14S,17R)-11,17-dihydroxy-1,10,13-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 3-(chloromethyl)benzoate |
| SMILES | CC1=CC(=O)C=C2CC[C@@H]3[C@H](C(O)C[C@@]4(C)[C@H]3CC[C@]4(O)C(=O)COC(=O)c3cccc(CCl)c3)[C@@]12C |
| InChI | InChI=1S/C30H35ClO6/c1-17-11-21(32)13-20-7-8-22-23-9-10-30(36,28(23,2)14-24(33)26(22)29(17,20)3)25(34)16-37-27(35)19-6-4-5-18(12-19)15-31/h4-6,11-13,22-24,26,33,36H,7-10,14-16H2,1-3H3/t22-,23-,24?,26+,28-,29-,30-/m0/s1 |
| InChIKey | NFNQJBVZNCJMGC-GTWTVDDCSA-N |
| XLogP | 4.55 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.06 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|