C33H36N2O6 — CID 58362980
[2-[(11S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 2-(3-pyrimidin-2-ylphenyl)acetate (PubChem CID 58362980) has the molecular formula C33H36N2O6 and a molecular weight of 556.66 g/mol. Its IUPAC name is [2-[(11S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 2-(3-pyrimidin-2-ylphenyl)acetate.
| Compound Name | [2-[(11S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 2-(3-pyrimidin-2-ylphenyl)acetate |
|---|---|
| PubChem CID | 58362980 |
| Molecular Formula | C33H36N2O6 |
| Molecular Weight | 556.66 g/mol |
| Exact Mass | 556.26 |
| IUPAC Name | [2-[(11S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 2-(3-pyrimidin-2-ylphenyl)acetate |
| SMILES | CC12C=CC(=O)C=C1CCC1C2C(O)CC2(C)C1CC[C@]2(O)C(=O)COC(=O)Cc1cccc(-c2ncccn2)c1 |
| InChI | InChI=1S/C33H36N2O6/c1-31-11-9-23(36)17-22(31)7-8-24-25-10-12-33(40,32(25,2)18-26(37)29(24)31)27(38)19-41-28(39)16-20-5-3-6-21(15-20)30-34-13-4-14-35-30/h3-6,9,11,13-15,17,24-26,29,37,40H,7-8,10,12,16,18-19H2,1-2H3/t24?,25?,26?,29?,31?,32?,33-/m0/s1 |
| InChIKey | BYLUVAHUFSVVNJ-QUFWSBLRSA-N |
| XLogP | 3.81 |
| TPSA | 126.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.66 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |