C33H38N2O6 — CID 160538654
[2-[(17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 2-[4-(1-methylpyrazol-3-yl)phenyl]acetate (PubChem CID 160538654) has the molecular formula C33H38N2O6 and a molecular weight of 558.68 g/mol. Its IUPAC name is [2-[(17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 2-[4-(1-methylpyrazol-3-yl)phenyl]acetate.
| Compound Name | [2-[(17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 2-[4-(1-methylpyrazol-3-yl)phenyl]acetate |
|---|---|
| PubChem CID | 160538654 |
| Molecular Formula | C33H38N2O6 |
| Molecular Weight | 558.68 g/mol |
| Exact Mass | 558.27 |
| IUPAC Name | [2-[(17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 2-[4-(1-methylpyrazol-3-yl)phenyl]acetate |
| SMILES | Cn1ccc(-c2ccc(CC(=O)OCC(=O)[C@@]3(O)CCC4C5CCC6=CC(=O)C=CC6(C)C5C(O)CC43C)cc2)n1 |
| InChI | InChI=1S/C33H38N2O6/c1-31-13-10-23(36)17-22(31)8-9-24-25-11-14-33(40,32(25,2)18-27(37)30(24)31)28(38)19-41-29(39)16-20-4-6-21(7-5-20)26-12-15-35(3)34-26/h4-7,10,12-13,15,17,24-25,27,30,37,40H,8-9,11,14,16,18-19H2,1-3H3/t24?,25?,27?,30?,31?,32?,33-/m0/s1 |
| InChIKey | ISHOMAUOTLLCEC-AORJUODPSA-N |
| XLogP | 3.75 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.68 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |