C34H44N2O6 — CID 160549403
[2-[(17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 2-[4-(4-methylpiperazin-1-yl)phenyl]acetate (PubChem CID 160549403) has the molecular formula C34H44N2O6 and a molecular weight of 576.73 g/mol. Its IUPAC name is [2-[(17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 2-[4-(4-methylpiperazin-1-yl)phenyl]acetate.
| Compound Name | [2-[(17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 2-[4-(4-methylpiperazin-1-yl)phenyl]acetate |
|---|---|
| PubChem CID | 160549403 |
| Molecular Formula | C34H44N2O6 |
| Molecular Weight | 576.73 g/mol |
| Exact Mass | 576.32 |
| IUPAC Name | [2-[(17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 2-[4-(4-methylpiperazin-1-yl)phenyl]acetate |
| SMILES | CN1CCN(c2ccc(CC(=O)OCC(=O)[C@@]3(O)CCC4C5CCC6=CC(=O)C=CC6(C)C5C(O)CC43C)cc2)CC1 |
| InChI | InChI=1S/C34H44N2O6/c1-32-12-10-25(37)19-23(32)6-9-26-27-11-13-34(41,33(27,2)20-28(38)31(26)32)29(39)21-42-30(40)18-22-4-7-24(8-5-22)36-16-14-35(3)15-17-36/h4-5,7-8,10,12,19,26-28,31,38,41H,6,9,11,13-18,20-21H2,1-3H3/t26?,27?,28?,31?,32?,33?,34-/m0/s1 |
| InChIKey | LMKFHSUOELNUOB-LCUZGZHJSA-N |
| XLogP | 3.10 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.73 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|