C16H17ClN2O3 — CID 70505101
5-[chloro(isoquinolin-5-yloxy)methyl]-3-propan-2-yl-1,3-oxazolidin-2-one (PubChem CID 70505101) has the molecular formula C16H17ClN2O3 and a molecular weight of 320.78 g/mol. Its IUPAC name is 5-[chloro(isoquinolin-5-yloxy)methyl]-3-propan-2-yl-1,3-oxazolidin-2-one.
| Compound Name | 5-[chloro(isoquinolin-5-yloxy)methyl]-3-propan-2-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 70505101 |
| Molecular Formula | C16H17ClN2O3 |
| Molecular Weight | 320.78 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 5-[chloro(isoquinolin-5-yloxy)methyl]-3-propan-2-yl-1,3-oxazolidin-2-one |
| SMILES | CC(C)N1CC(C(Cl)Oc2cccc3cnccc23)OC1=O |
| InChI | InChI=1S/C16H17ClN2O3/c1-10(2)19-9-14(22-16(19)20)15(17)21-13-5-3-4-11-8-18-7-6-12(11)13/h3-8,10,14-15H,9H2,1-2H3 |
| InChIKey | ITWPFOLMSWJMTF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.78 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|