C19H29NO3S — CID 70505326
ethyl 2-(2-ethyl-6-methyl-N-(2-propan-2-ylsulfanylacetyl)anilino)propanoate (PubChem CID 70505326) has the molecular formula C19H29NO3S and a molecular weight of 351.51 g/mol. Its IUPAC name is ethyl 2-(2-ethyl-6-methyl-N-(2-propan-2-ylsulfanylacetyl)anilino)propanoate.
| Compound Name | ethyl 2-(2-ethyl-6-methyl-N-(2-propan-2-ylsulfanylacetyl)anilino)propanoate |
|---|---|
| PubChem CID | 70505326 |
| Molecular Formula | C19H29NO3S |
| Molecular Weight | 351.51 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | ethyl 2-(2-ethyl-6-methyl-N-(2-propan-2-ylsulfanylacetyl)anilino)propanoate |
| SMILES | CCOC(=O)C(C)N(C(=O)CSC(C)C)c1c(C)cccc1CC |
| InChI | InChI=1S/C19H29NO3S/c1-7-16-11-9-10-14(5)18(16)20(15(6)19(22)23-8-2)17(21)12-24-13(3)4/h9-11,13,15H,7-8,12H2,1-6H3 |
| InChIKey | MWZJAZNZFQXCHB-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.51 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |