C12H15Cl2NO — CID 90701273
N,2-dichloro-N-(2-ethyl-6-methylphenyl)propanamide (PubChem CID 90701273) has the molecular formula C12H15Cl2NO and a molecular weight of 260.16 g/mol. Its IUPAC name is N,2-dichloro-N-(2-ethyl-6-methylphenyl)propanamide.
| Compound Name | N,2-dichloro-N-(2-ethyl-6-methylphenyl)propanamide |
|---|---|
| PubChem CID | 90701273 |
| Molecular Formula | C12H15Cl2NO |
| Molecular Weight | 260.16 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | N,2-dichloro-N-(2-ethyl-6-methylphenyl)propanamide |
| SMILES | CCc1cccc(C)c1N(Cl)C(=O)C(C)Cl |
| InChI | InChI=1S/C12H15Cl2NO/c1-4-10-7-5-6-8(2)11(10)15(14)12(16)9(3)13/h5-7,9H,4H2,1-3H3 |
| InChIKey | MKRMQRKSSFZHLP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.16 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|