C30H35NO2 — CID 70505468
(3,5-ditert-butylphenyl) (E)-2-methyl-3-[4-(pyridin-3-ylmethyl)phenyl]prop-2-enoate (PubChem CID 70505468) has the molecular formula C30H35NO2 and a molecular weight of 441.62 g/mol. Its IUPAC name is (3,5-ditert-butylphenyl) (E)-2-methyl-3-[4-(pyridin-3-ylmethyl)phenyl]prop-2-enoate.
| Compound Name | (3,5-ditert-butylphenyl) (E)-2-methyl-3-[4-(pyridin-3-ylmethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 70505468 |
| Molecular Formula | C30H35NO2 |
| Molecular Weight | 441.62 g/mol |
| Exact Mass | 441.27 |
| IUPAC Name | (3,5-ditert-butylphenyl) (E)-2-methyl-3-[4-(pyridin-3-ylmethyl)phenyl]prop-2-enoate |
| SMILES | C/C(=C\c1ccc(Cc2cccnc2)cc1)C(=O)Oc1cc(C(C)(C)C)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C30H35NO2/c1-21(15-22-10-12-23(13-11-22)16-24-9-8-14-31-20-24)28(32)33-27-18-25(29(2,3)4)17-26(19-27)30(5,6)7/h8-15,17-20H,16H2,1-7H3/b21-15+ |
| InChIKey | JTANBUHWECMMFF-RCCKNPSSSA-N |
| XLogP | 7.28 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.62 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|