C30H30N2O3 — CID 70505931
benzyl 3-[2-(dibenzylamino)ethylidene]-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 70505931) has the molecular formula C30H30N2O3 and a molecular weight of 466.58 g/mol. Its IUPAC name is benzyl 3-[2-(dibenzylamino)ethylidene]-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | benzyl 3-[2-(dibenzylamino)ethylidene]-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 70505931 |
| Molecular Formula | C30H30N2O3 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | benzyl 3-[2-(dibenzylamino)ethylidene]-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | O=C(OCc1ccccc1)C1C(=CCN(Cc2ccccc2)Cc2ccccc2)CC2CC(=O)N21 |
| InChI | InChI=1S/C30H30N2O3/c33-28-19-27-18-26(29(32(27)28)30(34)35-22-25-14-8-3-9-15-25)16-17-31(20-23-10-4-1-5-11-23)21-24-12-6-2-7-13-24/h1-16,27,29H,17-22H2 |
| InChIKey | AOYSZWVOEUQKKC-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|