C10H16N2O5S — CID 70506212
(2S,5R,6S)-6-[(1S)-1-aminoethyl]-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 70506212) has the molecular formula C10H16N2O5S and a molecular weight of 276.31 g/mol. Its IUPAC name is (2S,5R,6S)-6-[(1S)-1-aminoethyl]-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,5R,6S)-6-[(1S)-1-aminoethyl]-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 70506212 |
| Molecular Formula | C10H16N2O5S |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | (2S,5R,6S)-6-[(1S)-1-aminoethyl]-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | C[C@H](N)[C@H]1C(=O)N2[C@@H](C(=O)O)C(C)(C)S(=O)(=O)[C@H]12 |
| InChI | InChI=1S/C10H16N2O5S/c1-4(11)5-7(13)12-6(9(14)15)10(2,3)18(16,17)8(5)12/h4-6,8H,11H2,1-3H3,(H,14,15)/t4-,5-,6-,8+/m0/s1 |
| InChIKey | BVNIVELSYDZSFC-VUBPFVNUSA-N |
| XLogP | -1.22 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |