C10H13N2NaO6S — CID 53322130
sodium (2S,5R,6R)-6-(formamidomethyl)-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 53322130) has the molecular formula C10H13N2NaO6S and a molecular weight of 312.28 g/mol. Its IUPAC name is sodium (2S,5R,6R)-6-(formamidomethyl)-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | sodium (2S,5R,6R)-6-(formamidomethyl)-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 53322130 |
| Molecular Formula | C10H13N2NaO6S |
| Molecular Weight | 312.28 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | sodium (2S,5R,6R)-6-(formamidomethyl)-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC1(C)[C@H](C(=O)[O-])N2C(=O)[C@@H](CNC=O)[C@H]2S1(=O)=O.[Na+] |
| InChI | InChI=1S/C10H14N2O6S.Na/c1-10(2)6(9(15)16)12-7(14)5(3-11-4-13)8(12)19(10,17)18;/h4-6,8H,3H2,1-2H3,(H,11,13)(H,15,16);/q;+1/p-1/t5-,6+,8-;/m1./s1 |
| InChIKey | RSXBISVPPUDQMZ-XJNRBXITSA-M |
| XLogP | -6.15 |
| TPSA | 123.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.28 |
| LogP ≤ 5 | -6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|