C10H12N2Na2O7S — CID 53321736
disodium;(2S,5R,6R)-6-(carboxylatomethylamino)-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 53321736) has the molecular formula C10H12N2Na2O7S and a molecular weight of 350.26 g/mol. Its IUPAC name is disodium;(2S,5R,6R)-6-(carboxylatomethylamino)-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | disodium;(2S,5R,6R)-6-(carboxylatomethylamino)-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 53321736 |
| Molecular Formula | C10H12N2Na2O7S |
| Molecular Weight | 350.26 g/mol |
| Exact Mass | 350.02 |
| IUPAC Name | disodium;(2S,5R,6R)-6-(carboxylatomethylamino)-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC1(C)[C@H](C(=O)[O-])N2C(=O)[C@@H](NCC(=O)[O-])[C@H]2S1(=O)=O.[Na+].[Na+] |
| InChI | InChI=1S/C10H14N2O7S.2Na/c1-10(2)6(9(16)17)12-7(15)5(11-3-4(13)14)8(12)20(10,18)19;;/h5-6,8,11H,3H2,1-2H3,(H,13,14)(H,16,17);;/q;2*+1/p-2/t5-,6+,8-;;/m1../s1 |
| InChIKey | PQDOEERCGASABZ-DJVKKHGRSA-L |
| XLogP | -10.80 |
| TPSA | 146.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.26 |
| LogP ≤ 5 | -10.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |