C10H13N2NaO7S — CID 53319512
sodium (2S,5R,6R)-6-[2-(hydroxyamino)-2-oxoethyl]-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 53319512) has the molecular formula C10H13N2NaO7S and a molecular weight of 328.28 g/mol. Its IUPAC name is sodium (2S,5R,6R)-6-[2-(hydroxyamino)-2-oxoethyl]-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | sodium (2S,5R,6R)-6-[2-(hydroxyamino)-2-oxoethyl]-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 53319512 |
| Molecular Formula | C10H13N2NaO7S |
| Molecular Weight | 328.28 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | sodium (2S,5R,6R)-6-[2-(hydroxyamino)-2-oxoethyl]-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC1(C)[C@H](C(=O)[O-])N2C(=O)[C@@H](CC(=O)NO)[C@H]2S1(=O)=O.[Na+] |
| InChI | InChI=1S/C10H14N2O7S.Na/c1-10(2)6(9(15)16)12-7(14)4(3-5(13)11-17)8(12)20(10,18)19;/h4,6,8,17H,3H2,1-2H3,(H,11,13)(H,15,16);/q;+1/p-1/t4-,6+,8-;/m1./s1 |
| InChIKey | AXOFTDAHYITYHZ-PGPOWMLISA-M |
| XLogP | -6.00 |
| TPSA | 143.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.28 |
| LogP ≤ 5 | -6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|