C21H19N3OS — CID 70510356
(3-benzyl-4-sulfanylidene-1,5,7,8-tetrahydropyrido[4,3-c]pyridazin-6-yl)-phenylmethanone (PubChem CID 70510356) has the molecular formula C21H19N3OS and a molecular weight of 361.47 g/mol. Its IUPAC name is (3-benzyl-4-sulfanylidene-1,5,7,8-tetrahydropyrido[4,3-c]pyridazin-6-yl)-phenylmethanone.
| Compound Name | (3-benzyl-4-sulfanylidene-1,5,7,8-tetrahydropyrido[4,3-c]pyridazin-6-yl)-phenylmethanone |
|---|---|
| PubChem CID | 70510356 |
| Molecular Formula | C21H19N3OS |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | (3-benzyl-4-sulfanylidene-1,5,7,8-tetrahydropyrido[4,3-c]pyridazin-6-yl)-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1CCc2[nH]nc(Cc3ccccc3)c(=S)c2C1 |
| InChI | InChI=1S/C21H19N3OS/c25-21(16-9-5-2-6-10-16)24-12-11-18-17(14-24)20(26)19(23-22-18)13-15-7-3-1-4-8-15/h1-10H,11-14H2,(H,22,26) |
| InChIKey | SXACJBYQUJGYRZ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|