C21H20N4O — CID 31193787
(E)-1-(3-benzyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl)-3-pyridin-2-ylprop-2-en-1-one (PubChem CID 31193787) has the molecular formula C21H20N4O and a molecular weight of 344.42 g/mol. Its IUPAC name is (E)-1-(3-benzyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl)-3-pyridin-2-ylprop-2-en-1-one.
| Compound Name | (E)-1-(3-benzyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl)-3-pyridin-2-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 31193787 |
| Molecular Formula | C21H20N4O |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | (E)-1-(3-benzyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl)-3-pyridin-2-ylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccccn1)N1CCc2[nH]nc(Cc3ccccc3)c2C1 |
| InChI | InChI=1S/C21H20N4O/c26-21(10-9-17-8-4-5-12-22-17)25-13-11-19-18(15-25)20(24-23-19)14-16-6-2-1-3-7-16/h1-10,12H,11,13-15H2,(H,23,24)/b10-9+ |
| InChIKey | ZAAFATVJAXYKDV-MDZDMXLPSA-N |
| XLogP | 2.99 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|