C16H17F3N2O2 — CID 70510380
3-methyl-1-pyrimidin-5-yl-2-[4-(trifluoromethoxy)phenyl]butan-2-ol (PubChem CID 70510380) has the molecular formula C16H17F3N2O2 and a molecular weight of 326.32 g/mol. Its IUPAC name is 3-methyl-1-pyrimidin-5-yl-2-[4-(trifluoromethoxy)phenyl]butan-2-ol.
| Compound Name | 3-methyl-1-pyrimidin-5-yl-2-[4-(trifluoromethoxy)phenyl]butan-2-ol |
|---|---|
| PubChem CID | 70510380 |
| Molecular Formula | C16H17F3N2O2 |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 3-methyl-1-pyrimidin-5-yl-2-[4-(trifluoromethoxy)phenyl]butan-2-ol |
| SMILES | CC(C)C(O)(Cc1cncnc1)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H17F3N2O2/c1-11(2)15(22,7-12-8-20-10-21-9-12)13-3-5-14(6-4-13)23-16(17,18)19/h3-6,8-11,22H,7H2,1-2H3 |
| InChIKey | LBOHYKCNBOHFRR-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |