C17H17F5N2O2 — CID 88721392
3-methyl-2-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1-pyrazin-2-ylbutan-2-ol (PubChem CID 88721392) has the molecular formula C17H17F5N2O2 and a molecular weight of 376.33 g/mol. Its IUPAC name is 3-methyl-2-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1-pyrazin-2-ylbutan-2-ol.
| Compound Name | 3-methyl-2-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1-pyrazin-2-ylbutan-2-ol |
|---|---|
| PubChem CID | 88721392 |
| Molecular Formula | C17H17F5N2O2 |
| Molecular Weight | 376.33 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 3-methyl-2-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1-pyrazin-2-ylbutan-2-ol |
| SMILES | CC(C)C(O)(Cc1cnccn1)c1ccc(OC(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H17F5N2O2/c1-11(2)15(25,9-13-10-23-7-8-24-13)12-3-5-14(6-4-12)26-17(21,22)16(18,19)20/h3-8,10-11,25H,9H2,1-2H3 |
| InChIKey | HARXCPGRUMHHQK-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.33 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|