C21H35ClN2O — CID 70511556
1-(4-chlorophenyl)-N,N-diethyl-3-methylcyclohexan-1-amine;morpholine (PubChem CID 70511556) has the molecular formula C21H35ClN2O and a molecular weight of 366.98 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N,N-diethyl-3-methylcyclohexan-1-amine;morpholine.
| Compound Name | 1-(4-chlorophenyl)-N,N-diethyl-3-methylcyclohexan-1-amine;morpholine |
|---|---|
| PubChem CID | 70511556 |
| Molecular Formula | C21H35ClN2O |
| Molecular Weight | 366.98 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | 1-(4-chlorophenyl)-N,N-diethyl-3-methylcyclohexan-1-amine;morpholine |
| SMILES | C1COCCN1.CCN(CC)C1(c2ccc(Cl)cc2)CCCC(C)C1 |
| InChI | InChI=1S/C17H26ClN.C4H9NO/c1-4-19(5-2)17(12-6-7-14(3)13-17)15-8-10-16(18)11-9-15;1-3-6-4-2-5-1/h8-11,14H,4-7,12-13H2,1-3H3;5H,1-4H2 |
| InChIKey | NJDGJEPSHANYLX-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.98 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |