C31H36FN7O — CID 70511657
N-[2-[4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]amino]piperidin-1-yl]ethyl]-N-pyrimidin-2-ylhex-5-enamide (PubChem CID 70511657) has the molecular formula C31H36FN7O and a molecular weight of 541.68 g/mol. Its IUPAC name is N-[2-[4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]amino]piperidin-1-yl]ethyl]-N-pyrimidin-2-ylhex-5-enamide.
| Compound Name | N-[2-[4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]amino]piperidin-1-yl]ethyl]-N-pyrimidin-2-ylhex-5-enamide |
|---|---|
| PubChem CID | 70511657 |
| Molecular Formula | C31H36FN7O |
| Molecular Weight | 541.68 g/mol |
| Exact Mass | 541.30 |
| IUPAC Name | N-[2-[4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]amino]piperidin-1-yl]ethyl]-N-pyrimidin-2-ylhex-5-enamide |
| SMILES | C=CCCCC(=O)N(CCN1CCC(Nc2nc3ccccc3n2Cc2ccc(F)cc2)CC1)c1ncccn1 |
| InChI | InChI=1S/C31H36FN7O/c1-2-3-4-10-29(40)38(30-33-17-7-18-34-30)22-21-37-19-15-26(16-20-37)35-31-36-27-8-5-6-9-28(27)39(31)23-24-11-13-25(32)14-12-24/h2,5-9,11-14,17-18,26H,1,3-4,10,15-16,19-23H2,(H,35,36) |
| InChIKey | BAIBBDIJKPMNNH-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.68 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|