About but-2-enedioic acid;8-[(1-methylimidazol-2-yl)methylsulfanyl]imidazo[1,2-a]pyrazine
but-2-enedioic acid;8-[(1-methylimidazol-2-yl)methylsulfanyl]imidazo[1,2-a]pyrazine (PubChem CID 70514362) has the molecular formula C15H15N5O4S
and a molecular weight of 361.38 g/mol. Its IUPAC name is but-2-enedioic acid;8-[(1-methylimidazol-2-yl)methylsulfanyl]imidazo[1,2-a]pyrazine.
Molecular Properties
| Compound Name | but-2-enedioic acid;8-[(1-methylimidazol-2-yl)methylsulfanyl]imidazo[1,2-a]pyrazine |
| PubChem CID | 70514362 |
| Molecular Formula | C15H15N5O4S |
| Molecular Weight | 361.38 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | but-2-enedioic acid;8-[(1-methylimidazol-2-yl)methylsulfanyl]imidazo[1,2-a]pyrazine |
| SMILES | Cn1ccnc1CSc1nccn2ccnc12.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C11H11N5S.C4H4O4/c1-15-5-2-12-9(15)8-17-11-10-13-3-6-16(10)7-4-14-11;5-3(6)1-2-4(7)8/h2-7H,8H2,1H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | VFPHVSRQXXJCIR-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 122.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.38 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze but-2-enedioic acid;8-[(1-methylimidazol-2-yl)methylsulfanyl]imidazo[1,2-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-2-enedioic acid;8-[(1-methylimidazol-2-yl)methylsulfanyl]imidazo[1,2-a]pyrazine?
The IUPAC name of but-2-enedioic acid;8-[(1-methylimidazol-2-yl)methylsulfanyl]imidazo[1,2-a]pyrazine (CID 70514362) is but-2-enedioic acid;8-[(1-methylimidazol-2-yl)methylsulfanyl]imidazo[1,2-a]pyrazine.
What is the SMILES notation for but-2-enedioic acid;8-[(1-methylimidazol-2-yl)methylsulfanyl]imidazo[1,2-a]pyrazine?
The canonical SMILES for but-2-enedioic acid;8-[(1-methylimidazol-2-yl)methylsulfanyl]imidazo[1,2-a]pyrazine is Cn1ccnc1CSc1nccn2ccnc12.O=C(O)C=CC(=O)O.
What is the InChIKey of but-2-enedioic acid;8-[(1-methylimidazol-2-yl)methylsulfanyl]imidazo[1,2-a]pyrazine?
The InChIKey is VFPHVSRQXXJCIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N5S.C4H4O4/c1-15-5-2-12-9(15)8-17-11-10-13-3-6-16(10)7-4-14-11;5-3(6)1-2-4(7)8/h2-7H,8H2,1H3;1-2H,(H,5,6)(H,7,8).
What are the key properties of but-2-enedioic acid;8-[(1-methylimidazol-2-yl)methylsulfanyl]imidazo[1,2-a]pyrazine?
but-2-enedioic acid;8-[(1-methylimidazol-2-yl)methylsulfanyl]imidazo[1,2-a]pyrazine has a molecular weight of 361.38 g/mol, XLogP of 1.47, 5 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for but-2-enedioic acid;8-[(1-methylimidazol-2-yl)methylsulfanyl]imidazo[1,2-a]pyrazine is sourced from PubChem (CID 70514362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).