About 2-(ethylsulfanylmethyl)-1-methylimidazole;platinum(2+);chloride
2-(ethylsulfanylmethyl)-1-methylimidazole;platinum(2+);chloride (PubChem CID 11567222) has the molecular formula C7H12ClN2PtS+
and a molecular weight of 386.79 g/mol. Its IUPAC name is 2-(ethylsulfanylmethyl)-1-methylimidazole;platinum(2+);chloride.
Molecular Properties
| Compound Name | 2-(ethylsulfanylmethyl)-1-methylimidazole;platinum(2+);chloride |
| PubChem CID | 11567222 |
| Molecular Formula | C7H12ClN2PtS+ |
| Molecular Weight | 386.79 g/mol |
| Exact Mass | 386.01 |
| IUPAC Name | 2-(ethylsulfanylmethyl)-1-methylimidazole;platinum(2+);chloride |
| SMILES | CCSCc1nccn1C.[Cl-].[Pt+2] |
| InChI | InChI=1S/C7H12N2S.ClH.Pt/c1-3-10-6-7-8-4-5-9(7)2;;/h4-5H,3,6H2,1-2H3;1H;/q;;+2/p-1 |
| InChIKey | LDFRGPVMHGISDF-UHFFFAOYSA-M |
| XLogP | -1.33 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.79 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(ethylsulfanylmethyl)-1-methylimidazole;platinum(2+);chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(ethylsulfanylmethyl)-1-methylimidazole;platinum(2+);chloride?
The IUPAC name of 2-(ethylsulfanylmethyl)-1-methylimidazole;platinum(2+);chloride (CID 11567222) is 2-(ethylsulfanylmethyl)-1-methylimidazole;platinum(2+);chloride.
What is the SMILES notation for 2-(ethylsulfanylmethyl)-1-methylimidazole;platinum(2+);chloride?
The canonical SMILES for 2-(ethylsulfanylmethyl)-1-methylimidazole;platinum(2+);chloride is CCSCc1nccn1C.[Cl-].[Pt+2].
What is the InChIKey of 2-(ethylsulfanylmethyl)-1-methylimidazole;platinum(2+);chloride?
The InChIKey is LDFRGPVMHGISDF-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H12N2S.ClH.Pt/c1-3-10-6-7-8-4-5-9(7)2;;/h4-5H,3,6H2,1-2H3;1H;/q;;+2/p-1.
What are the key properties of 2-(ethylsulfanylmethyl)-1-methylimidazole;platinum(2+);chloride?
2-(ethylsulfanylmethyl)-1-methylimidazole;platinum(2+);chloride has a molecular weight of 386.79 g/mol, XLogP of -1.33, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(ethylsulfanylmethyl)-1-methylimidazole;platinum(2+);chloride is sourced from PubChem (CID 11567222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).